| O-acylglycerone-phosphates | CHEMONTID:0003448 | Glycerone-3-phosphates carrying an acyl substituent at the 1-position. |
| O-alkylglycerone phosphates | CHEMONTID:0003447 | Glycerone-3-phosphates carrying an alkyl substituent at the 1-position. |
| O-alkylglycerones | CHEMONTID:0003445 | Organic compounds containing a glycerone that carries an acyl substituent at the 1-position or the 2-position. |
| O-alkylpyrimidines | CHEMONTID:0004486 | Compounds containing a pyrimidine , which is O-alkylated at one or more ring positions. |
| o-Aminophenols | CHEMONTID:0004654 | Phenols that are substituted with an amine group at the 2-position of the benzene ring. |
| O-benzoquinones | CHEMONTID:0002492 | Benzoquinones where the two C=O groups are attached at the 1- and 2-positions, respectively. |
| O-bromophenols | CHEMONTID:0002768 | Bromophenols carrying a iodine at the C2 position of the benzene ring. |
| O-chlorophenols | CHEMONTID:0002771 | Chlorophenols carrying a iodine at the C2 position of the benzene ring. |
| O-cinnamoyl glycosides | CHEMONTID:0003479 | O-glycoside derivatives of cinnamic acid. Cinnamic acid is an aromatic compound containing a benzene and a carboxylic acid group forming 3-phenylprop-2-enoic acid. |
| O-coumaroyl glycosides | CHEMONTID:0002684 | Glycosides of o-coumaric acids. O-coumaric acids are aromatic compounds containing a cinnamic acid moiety hydroxylated at the C2 carbon atom of the benzene ring. |
| O-fluorophenols | CHEMONTID:0002774 | Fluorophenols carrying a iodine at the C2 position of the benzene ring. |
| O-galloylquinic acids and derivatives | CHEMONTID:0002513 | Compounds containing a galloic acid moiety, linked to one hydroxyl group of a quinic acid moiety. |
| O-glucuronides | CHEMONTID:0002813 | Glucuronides in which the aglycone is linked to the carbohydrate unit through an O-glycosidic bond. |
| O-glycosyl compounds | CHEMONTID:0002207 | Glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond. |
| O-haloacetanilides | CHEMONTID:0004718 | Organic compounds containing an acetamide group conjugated to a phenyl group, which is in turn ortho-substituted with a halogen atom. |
| o-Hydroxybenzoic acid esters | CHEMONTID:0004700 | Benzoic acid esters where the benzene ring is ortho-substituted with a hydroxy group. |
| O-iminoquinones | CHEMONTID:0002388 | O-quinones that carry an imine group. |
| O-iodophenols | CHEMONTID:0002777 | Iodophenols carrying a iodine at the C2 position of the benzene ring. |
| O-methoxybenzoic acids and derivatives | CHEMONTID:0002345 | Benzoic acids in which the hydrogen atom at position 2 of the benzene ring is replaced by a methoxy group. |
| O-methylated flavonoids | CHEMONTID:0002585 | Flavonoids with methoxy groups conjugated to the flavonoid backbone. |
| O-methylated isoflavonoids | CHEMONTID:0002586 | Isoflavonoids with methoxy groups conjugated to the isoflavonoid backbone. Isoflavonoids are natural products derived from 3-phenylchromen-4-one. |
| O-phenylenediamines | CHEMONTID:0004746 | Aromatic compound containing a benzene ring which carries 2 amino groups, at the 1- and 2-positions. |
| O-phenylhydroxylamines | CHEMONTID:0004651 | Hydroxylamines that are O-substituted with a phenyl group. |
| o-Phthalate esters | CHEMONTID:0004011 | Ester derivatives of o-phthalic acids, which are based on a benzene 1,2-dicarboxylic acid skeleton. |
| O-phthalic acid and derivatives | CHEMONTID:0001107 | Compounds containing a benzene ring bearing a carboxylic acid group at ring carbon atoms 1 and 3. |
| O-quinodimethanes | CHEMONTID:0001778 | Compounds containing a benzene ring conjugated to two methylidene groups at carbon atoms 1 and 2, respectively. |
| O-quinomethanes | CHEMONTID:0002122 | Organic compounds containing a benzene ring conjugated to a methylidene group and a ketone at carbon atoms 1 and 2, respectively. |
| O-quinones | CHEMONTID:0002385 | Quinones where the two C=O groups are attached at the 1- and 2-positions, respectively. |
| O-quinonimines | CHEMONTID:0002894 | Quinonimines in which the imine groups are in a ortho-relationship. |
| O-sulfanylbenzoic acids | CHEMONTID:0003106 | Benzoic acids which bear a sulfanyl group (R-SH) attached to the benzene ring at positions 1 and 2, respectively. |
| O-sulfanylbenzoic acids and derivatives | CHEMONTID:0003105 | Benzoic acids (or derivatives) which bear a sulfanyl group (R-SH) attached to the benzene ring at positions 1 and 2, respectively. |
| O-terphenyls | CHEMONTID:0001836 | Terphenyls with a structure containing the 1,2-diphenylbenzene skeleton. |
| O-thiocarbamates | CHEMONTID:0004425 | O-ester derivatives of thiocarbamic acid, with the general formula ROC(=S)NR2. |
| o-Toluamides | CHEMONTID:0004221 | Aromatic compounds containing a toluene, which carries a carboxamide group a the 2-position. |
| o-Xylenes | CHEMONTID:0004210 | Aromatic compounds that contain a o-xylene moiety, which is a monocyclic benzene carrying exactly two methyl groups at the 1- and 2-positions. |
| o-Xylenols | CHEMONTID:0004214 | Aromatic compounds that contain a o-xylenol moiety, which is a monocyclic benzene carrying exactly two methyl groups at the 1- and 2-positions, and at least one hydroxyl group. |
| Ochratoxins and related substances | CHEMONTID:0001787 | A group of chemically related metabolites containing a 3,4-dihydro-3-methylisocoumarin moiety linked through a carboxyl group to L-beta-phenylalanine by a secondary amine bond. |
| Octoses | CHEMONTID:0001500 | Monosaccharide compounds in which the sugar moiety is an octose (8 carbon atoms). |
| Okadaic acids and derivatives | CHEMONTID:0001802 | Marine heterocyclic polyethers containing the okadaic acid skeleton. |
| Oleanane triterpenoids | CHEMONTID:0000180 | Triterpenoids with a structure based on the oleanane skeleton, an 4,4,6a,8a,11,14b-heptamethyl-hexadecahydropicene derivative. |
| Olefins | CHEMONTID:0002838 | Acyclic and cyclic hydrocarbons having one or more carbon-carbon double bonds, apart from the formal ones in aromatic compounds. The class of olefins subsumes alkenes and cycloalkenes and the corresponding polyenes. |
| Oligoanthrilamides | CHEMONTID:0001956 | Compounds containing several anthranilamide (2-aminobenzamide) moieties, where the amine group of one moiety is bound to the amide group of another moiety. |
| Oligocarbamates | CHEMONTID:0001955 | Compounds containing several carbamate groups linked to each other. |
| Oligonucleotides | CHEMONTID:0004351 | Organic polymers made up of a sequence of 3 to 12 purine or pyrimidine nucleotide residues linked to one another from the 5' -end to the 3'-end through a phosphate group. |
| Oligopeptides | CHEMONTID:0004831 | Organic compounds containing a sequence of between three and ten alpha-amino acids joined by peptide bonds. |
| Oligophosphenes | CHEMONTID:0002488 | Organophosphorus compounds with the general formula RP=P-PR' (R=alkyl, aryl). |
| Oligosaccharide phosphates | CHEMONTID:0002191 | Carbohydrates containing between 3 and 9 sugar units, one of which bear one or more phosphate groups. |
| Oligosaccharide sulfates | CHEMONTID:0003308 | Carbohydrates containing between 3 and 9 sugar units, one of which bear one or more sulfate groups. |
| Oligosaccharides | CHEMONTID:0000198 | Carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds. |
| Oligosulfones | CHEMONTID:0001954 | Compounds containing several sulfone groups linked to each other. |
| Oligosulfoxides | CHEMONTID:0001953 | Compounds containing several sulfoxide groups linked to each other. They have the general formula R1(S(O)C(R2)C)nC (R1 = organyl; R2=any group). |
| Oligothioureas | CHEMONTID:0001944 | Compounds containing several thiourea groups linked to each other. |
| Oligourea amides | CHEMONTID:0001952 | Compounds containing several urea-amide units (RNC(=O)CNC(=O)N(R')CN), which consists of alternating amide and urea functional groups. |
| Oligoureas | CHEMONTID:0001951 | Compounds containing several urea groups linked to each other. Urea is an organic compound with the formula CO(NH2)2. |
| Ophiobolane sesterterpenoids | CHEMONTID:0002882 | Sesterterpnoids with a structure based on the ophiobolane backbone. Ophiobolane is a tricyclic compound consisting of two cyclopentane rings joined by a cyclooctane ring, and carries a methyl group at the 1-, 4-, and 8-position, as well as a 6-methylheptane group at the 12-position. |
| Organic 1,3-dipolar compounds | CHEMONTID:0003630 | Electrically neutral organic molecules carrying a positive and a negative charge in one of their major canonical descriptions. In most dipolar compounds the charges are delocalized; however the term is also applied to species where this is not the case. The term 1,3-dipolar compounds is used for those in which a significant canonical resonance form can be represented by a separation of charge over three atoms (in connection with 1,3-dipolar cycloadditions). |
| Organic acids and derivatives | CHEMONTID:0000264 | Compounds an organic acid or a derivative thereof. |
| Organic alkali metal salts | CHEMONTID:0004099 | Organic salts of an alkali metal. The alkali metal atom is usually in its ionic form. |
| Organic aluminates | CHEMONTID:0001839 | Organic compounds containing an aluminate oxoanion, with the formula [AlO2]-. |
| Organic aluminium salts | CHEMONTID:0004041 | Organic salt compounds containing a tin atom in its ionic form. |
| Organic anions | CHEMONTID:0003608 | Organic compounds that have a negative electric charge. |
| Organic antimonates | CHEMONTID:0001740 | Organic compounds containing the antimonate oxoanion, with the formula Sb(OH)6-. |
| Organic antimony salts | CHEMONTID:0004078 | Organic salts of antimony. They usually contain antimony in its ionic form. |
| Organic arsenates | CHEMONTID:0001806 | Organic compounds containing the arsenate oxoanion, with the formula AsO43-. |
| Organic azides | CHEMONTID:0000126 | Compounds bearing the group N3, viz. -N=N+=N-; usually attached to carbon, e.g. PhN3 phenyl azide or azidobenzene. |
| Organic beryllium salts | CHEMONTID:0004489 | Organic compounds containing a beryllium ion. |
| Organic bromate salts | CHEMONTID:0004458 | Organic salts of bromate. They contain bromate in its ionic form or conjugated to a metal atom. |
| Organic bromates | CHEMONTID:0001259 | Organic compounds containing the bromate oxoanion, with the formula BrO3-. |
| Organic bromide salts | CHEMONTID:0003930 | Organic compounds containing a bromine ion. |
| Organic cadmium salts | CHEMONTID:0004075 | Organic salts of cadmium. They usually contain cadmium in its ionic form. |
| Organic calcium salts | CHEMONTID:0004493 | Organic salts containing a calcium ion. |
| Organic carbonic acids | CHEMONTID:0001521 | Compounds comprising the carbonic acid functional group. |
| Organic carbonic acids and derivatives | CHEMONTID:0000364 | Compounds comprising the organic carbonic acid or a derivative thereof. |
| Organic cations | CHEMONTID:0003609 | Organic compounds with a positive electric charge. |
| Organic chlorates | CHEMONTID:0001260 | Organic compounds containing the chlorate oxoanion, with the formula ClO3-. |
| Organic chloride salts | CHEMONTID:0003931 | Organic compounds containing a chlorine ion. |
| Organic chlorite salts | CHEMONTID:0004462 | Organic salts containing the chlorite group, in its ionic form or bound to a metal atom. |
| Organic chlorites | CHEMONTID:0001261 | Organic compounds containing the chlorite oxoanion, with the formula ClO2-. |
| Organic chromates | CHEMONTID:0001278 | Organic compounds containing the chromate oxoanion, with the formula [CrO4]2-. |
| Organic chromites | CHEMONTID:0001307 | Organic compounds containing the chromate oxoanion, with the formula Cr(O2)−. |
| Organic chromium salts | CHEMONTID:0004369 | Organic salt compounds containing a chromium atom in its ionic form. |
| Organic chromium trioxides | CHEMONTID:0004820 | Organic compounds containing a chromium trioxide moiety. |
| Organic cobalt salts | CHEMONTID:0003995 | Organic salt compounds containing a cobalt atom in its ionic form. |
| Organic compounds | CHEMONTID:0000000 | Compounds that contain at least one carbon atom, excluding isocyanide/cyanide and their non-hydrocarbyl derivatives, thiophosgene, carbon diselenide, carbon monosulfide, carbon disulfide, carbon subsulfide, carbon monoxide, carbon dioxide, Carbon suboxide, and dicarbon monoxide. |
| Organic copper salts | CHEMONTID:0004018 | Organic salt compounds containing a copper atom in its ionic form. |
| Organic cyanamides | CHEMONTID:0000361 | Organic compounds comprising the cyanamide functional group, with the general structure R1N=C=NR2. |
| Organic cyanides | CHEMONTID:0004504 | Organic nitrogen compounds that contain the cyano (C#N) group. The group can be present either in the anionic or covalently bond form. |
| Organic diazonium salts | CHEMONTID:0001668 | Organic compounds comprising the diazonium functional group, with the general structure R-N=N+. |
| Organic dichromates | CHEMONTID:0004803 | Organic compounds containing a dichromate moiety. |
| Organic disulfides | CHEMONTID:0002800 | Organosulfur compounds with the general formula RSSR' (R,R' = alkyl, aryl). |
| Organic dithionites | CHEMONTID:0002081 | Organic compounds containing the dithionite oxoanion, with the formula [S2O4]2−. |
| Organic dithiophosphoric acids and derivatives | CHEMONTID:0003385 | Organic compounds that contain dithiophosphoric acid or a derivative thereof, with the general formula ROP(S)(=S)OR', (R,R'=H, or organyl group). |
| Organic fluorophosphonic acids and derivatives | CHEMONTID:0001247 | Organic compounds containing fluorophosphonic acid or a derivative thereof. |
| Organic hydroperoxides | CHEMONTID:0001308 | Organic compounds comprising the hydroperoxide functional group, with the general formula [O-O]2-. |
| Organic hydroxides | CHEMONTID:0001364 | Organic compounds comprising the hydroxide functional group, with the general formula OH-. |
| Organic hypobromites | CHEMONTID:0001444 | Organic compounds containing the hypobromite oxoanion, with the formula BrO-. |
| Organic hypochlorites | CHEMONTID:0001526 | Organic compounds containing the hypochlorite oxoanion, with the formula ClO-. |
| Organic hyponitrites | CHEMONTID:0001577 | Organic compounds containing the hyponitrite oxoanion, with the formula ([ON=NO]2-. |
| Organic hypophosphites | CHEMONTID:0001589 | Organic compounds containing the hypophosphite oxoanion, with the formula PO2−. |
| Organic hyposulfites | CHEMONTID:0002082 | Organic compounds containing the hyposulfite oxoanion, with the formula [SO2]2-. |
| Organic iodate salts | CHEMONTID:0004460 | Organic salts containing the iodate group, in its ionic form or bound to a metal atom. |
| Organic iodates | CHEMONTID:0001590 | Organic compounds containing the iodate oxoanion, with the formula IO3-. |
| Organic iodide salts | CHEMONTID:0003932 | Organic compounds containing a iodine ion. |
| Organic isocyanides | CHEMONTID:0001306 | Organic compounds containing the isomer HN+#C- of hydrocyanic acid, HC#N, or its hydrocarbyl derivatives RNC (RN+#C-). |
| Organic lead salts | CHEMONTID:0004051 | Organic salts containing a lead ion. |
| Organic lithium salts | CHEMONTID:0004488 | Organic compounds containing a lithium ion. |
| Organic metal bromide salts | CHEMONTID:0004037 | Organic metal salts containing a bromine atom in its ionic form. |
| Organic metal halides | CHEMONTID:0004491 | Organic compounds containing metals and halogens. Some are ionic while others are covalently bonded. |
| Organic metal salts | CHEMONTID:0004036 | Organic salt compounds containing a metal atom in its ionic form. |
| Organic metalloid salts | CHEMONTID:0003998 | Organic salt compounds containing a metalloid atom in its ionic form. |
| Organic metavanadates | CHEMONTID:0003294 | Organic compounds containing the metavanadate oxoanion, with the formula [VO4]3-. |
| Organic N-nitroso compounds | CHEMONTID:0004777 | Organic compounds containing a n-nitroso group -NN=O. |
| Organic nitrates | CHEMONTID:0000395 | Organic compounds containing the nitrate oxoanion, with the formula NO3-. |
| Organic nitrenes | CHEMONTID:0003973 | Compounds containing a bond between a carbon and a nitrogen atom with only 2 pairs of unshared electrons. |
| Organic nitric acids | CHEMONTID:0002487 | Compounds containing an organonitric acid group. |
| Organic nitric acids and derivatives | CHEMONTID:0000488 | Compounds containing an organonitric acid group or a derivative thereof. |
| Organic nitrites | CHEMONTID:0000396 | Organic compounds containing the nitrite oxoanion, with the formula NO2-. |
| Organic nitro compounds | CHEMONTID:0001152 | Compounds having the nitro group, -NO2 (free valence on nitrogen), which may be attached to carbon, nitrogen (as in nitramines), or oxygen (as in nitrates), among other elements (in the absence of specification, C-nitro compounds are usually implied). |
| Organic nitrogen compounds | CHEMONTID:0004707 | Organic compounds containing a nitrogen atom. |
| Organic nitrosamines | CHEMONTID:0001400 | Organic compounds containing the nitrosamine functional group, with the structure R2NN=O. |
| Organic nitroso compounds | CHEMONTID:0004776 | Organic compounds having the nitroso group, -NO, attached to carbon, or to another element, most commonly nitrogen or oxygen. |
| Organic nitrosonium compounds | CHEMONTID:0001520 | Organic compounds containing the nitrosonium cation, with the general formula NO+. |
| Organic O-nitroso compounds | CHEMONTID:0004778 | Organic compounds containing a n-nitroso group -ON=O. |
| Organic orthonitrates | CHEMONTID:0002065 | Organic compounds containing the orhthonitrate oxoanion, with the formula [NO4]3−. |
| Organic orthovanadates | CHEMONTID:0001841 | Organic compounds containing the orthovanadate oxoanion, with the formula [VO4]3-. |
| Organic oxides | CHEMONTID:0003940 | Organic compounds containing an oxide group. |
| Organic oxoanionic compounds | CHEMONTID:0000463 | Organic compounds containing an oxoanion. |
| Organic oxoazanium compounds | CHEMONTID:0001508 | Organic compounds comprising the oxoazanium cation, with the formula N+=O. |
| Organic oxygen compounds | CHEMONTID:0004603 | Organic compounds that contain one or more oxygen atoms. |
| Organic perbromates | CHEMONTID:0002066 | Organic compounds containing the perbromate oxoanion, with the formula [BrO4]-. |
| Organic perchlorate salts | CHEMONTID:0003933 | Organic compounds containing a perchlorate ion. |
| Organic perchlorates | CHEMONTID:0002067 | Organic compounds containing the perchlorate oxoanion, with the formula [ClO4]-. |
| Organic periodates | CHEMONTID:0002068 | Organic compounds containing the periodate oxoanion, with the formula [IO4]-. |
| Organic permanganates | CHEMONTID:0002069 | Organic compounds containing the permanganate oxoanion, with the formula [MnO4]-. |
| Organic peroxides | CHEMONTID:0000414 | Organic compounds containing the peroxide group, with the formula R1OOR2 (R1,R2=H, alkyl, aryl). |
| Organic peroxodisulfates | CHEMONTID:0002077 | Organic compounds containing the peroxodisulfate oxoanion, with the formula [S2O8]2−. |
| Organic peroxomonosulfates | CHEMONTID:0002076 | Organic compounds containing the peroxomonosulfate oxoanion, with the formula [SO5]2-. |
| Organic peroxynitrates | CHEMONTID:0001837 | Organic compounds containing the peroxynitrate oxoanion, with the formula [NO4]−. |
| Organic peroxynitrites | CHEMONTID:0001838 | Organic compounds containing the peroxonitrite oxoanion, with the formula ONOO-. |
| Organic perrhenates | CHEMONTID:0001222 | Organic compounds containing the perrhenate oxoanion, with the formula [ReO4]-. |
| Organic pertechnetates | CHEMONTID:0002070 | Organic compounds containing the pertechnetate oxoanion, with the formula [TcO4]-. |
| Organic phosphines and derivatives | CHEMONTID:0000401 | Organic compounds containing a phosphine derivative, with the general formula B1P(R2)R3 (R1-R3=alkyl, aryl). |
| Organic phosphite salts | CHEMONTID:0004463 | Organic salts containing a phosphite group, in its ionic form or bound to a metal atom. |
| Organic phosphites | CHEMONTID:0002071 | Organic compounds containing the phosphite oxoanion, with the formula [PO3]3-. |
| Organic phosphonic acid diamides | CHEMONTID:0003892 | Organophosphorus compounds containing a diamide derivative of phosphonic acid, with the general structure R1P(=O)(N(R2)R3)N(R4)R5, where R = organyl and R2-R5 = H or organyl group. |
| Organic phosphonic acids | CHEMONTID:0001302 | Organic compounds containing phosphonic acid. |
| Organic phosphonic acids and derivatives | CHEMONTID:0000419 | Organic compounds containing phosphonic acid or a derivative thereof. |
| Organic phosphoramides | CHEMONTID:0001204 | Organic compounds containing the phosphoric acid amide functional group. |
| Organic phosphoric acid diamides | CHEMONTID:0003662 | Organophosphorus compounds with the general formula RNP(R2)(O)=O (R=alkyl, aryl; R2 = amine group). |
| Organic phosphoric acid halides | CHEMONTID:0001206 | Organic compounds containing the phosphoric acid halide functional group with the general structure OP(O)(=O)OX (X = halogen atom). |
| Organic phosphoric acid monoamides | CHEMONTID:0002857 | Organophosphorus compounds with the general formula RNP(O)(O)=O (R=alkyl, aryl). |
| Organic phosphoric acid triamides | CHEMONTID:0003871 | Organophosphorus compounds with the general formula RNP(R2)(R3)=O (R=alkyl, aryl; R2-R3 = amine groups). |
| Organic phosphoric acids | CHEMONTID:0001574 | Organic compounds containing phosphoric acid, with the general structure OP(O)(=O)O. |
| Organic phosphoric acids and derivatives | CHEMONTID:0000402 | Organic compounds containing phosphoric acid or a derivative thereof. |
| Organic plumbates | CHEMONTID:0001153 | Organic compounds containing a plumbate oxoanion, with the formula [PbO3]2-. |
| Organic Polymers | CHEMONTID:0003297 | Organic compounds, generally large molecules or macromolecules, which are composed of many repeating units. |
| Organic post-transition metal salts | CHEMONTID:0004040 | Organic salt compounds containing a post-transition metal atom in its ionic form. |
| Organic potassium salts | CHEMONTID:0003927 | Organic compounds containing a potassium ion. |
| Organic pyrophosphates | CHEMONTID:0001804 | Organic compounds containing the pyrophosphate oxoanion, with the structure OP([O-])(=O)OP(O)([O-])=O. |
| Organic pyrosulfates | CHEMONTID:0002078 | Organic compounds containing the pyrosulfate oxoanion, with the structure OS([O-])(=O)OS(O)([O-])=O. |
| Organic S-nitroso compounds | CHEMONTID:0004779 | Organic compounds containing a n-nitroso group -SN=O. |
| Organic salts | CHEMONTID:0003865 | Organic compounds consisting of an assembly of cations and anions. |
| Organic selenates | CHEMONTID:0002072 | Organic compounds containing the selenate oxoanion, with the formula [SeO4]2-. |
| Organic selenite salts | CHEMONTID:0004459 | Organic salts containing a selenite group, in its ionic form or bound to a metal atom. |
| Organic selenites | CHEMONTID:0002073 | Organic compounds containing the selenite oxoanion, with the formula [SeO3]2-. |
| Organic silver salts | CHEMONTID:0004063 | Organic salt compounds containing a copper atom either in its ionic form or bonded to another atom. |
| Organic sodium salts | CHEMONTID:0003928 | Organic compounds containing a sodium ion. |
| Organic stannates | CHEMONTID:0001840 | Organic compounds containing a stannate oxoanion, with the formula [SnO3]2-. |
| Organic sulfate salts | CHEMONTID:0003929 | Organic compounds containing a sulfate ion. |
| Organic sulfite salts | CHEMONTID:0004455 | Organic salts of the sulfite ion. |
| Organic sulfites | CHEMONTID:0004456 | Organic compounds containing the selenite oxoanion, with the formula [SO3]2-, or its conjugated base. |
| Organic sulfonamides | CHEMONTID:0004439 | Organic compounds containing the sulfonamide functional group, an amide of sulfonic acid with the general structure R1S(=O)2N(R2)R3 (R1=H or organyl; R2,R3=H, alkyl, aryl). |
| Organic sulfonic acids | CHEMONTID:0004438 | Organic compounds containing a sulfonic acid or derivative, with the general structure RS(=O)2OH (R= H or organyl group). |
| Organic sulfonic acids and derivatives | CHEMONTID:0004434 | Compounds containing a sulfonic acid or derivative, with the general structure RS(=O)2X (R= H or organyl group, X=any heteroatom). |
| Organic sulfonic anhydrides | CHEMONTID:0004437 | Organic compounds having the structure RS(=O)2OS(=O)2R', where R , R' = H or organyl group. |
| Organic sulfonium compounds | CHEMONTID:0000508 | Organic compounds containing the sulfonium cation, with the general formula [SR3]+ (R=any atom). |
| Organic sulfuric acids | CHEMONTID:0001180 | Organic compounds containing the sulfuric acid functional group, with the generic structure HOS(=O)(=O)OH. |
| Organic sulfuric acids and derivatives | CHEMONTID:0000403 | Organic compounds containing the sulfuric acid or a derivative thereof. |
| Organic sulfuryl bromides | CHEMONTID:0001037 | Organic compounds containing the sulfuryl bromide functional group. |
| Organic sulfuryl chlorides | CHEMONTID:0001038 | Organic compounds containing the sulfuryl chloride functional group. |
| Organic sulfuryl fluorides | CHEMONTID:0001039 | Organic compounds containing the sulfuryl fluoride functional group. |
| Organic sulfuryl halides | CHEMONTID:0002869 | Organic compounds containing the sulfuryl halide group. |
| Organic sulfuryl iodides | CHEMONTID:0001040 | Organic compounds containing the sulfuryl iodide functional group. |
| Organic superoxides | CHEMONTID:0000230 | Organic compounds containing a superoxide oxyanion. |
| Organic tetrathionates | CHEMONTID:0002079 | Organic compounds containing the tetrathionate oxoanion, with the formula [S4O6]2−. |
| Organic thiocarbonic acid derivatives | CHEMONTID:0001672 | Organic compounds containing the thiocarbonic acid structure or a derivative thereof. |
| Organic thiocarbonic acids | CHEMONTID:0001193 | Organic compounds comprising the thiocarbonic acid group, with the general structure HOC(=S)OH. |
| Organic thionitrous acids | CHEMONTID:0004780 | Organic compounds containing a thionitrous acid, -HSN=O. |
| Organic thionylimides | CHEMONTID:0003699 | Organic compounds that contain the thionylimide group (N=S=O). |
| Organic thioperoxides | CHEMONTID:0003135 | Organosulfur compounds with the general formula RSOR' (R,R' = organyl). |
| Organic thiophosphonic acid derivatives | CHEMONTID:0001163 | Organic compounds containing thiophosphonic acid functional group. Thiophosphonic acid is a phosphorus compound with the formula OP(O)(=S). |
| Organic thiophosphoric acid amides | CHEMONTID:0001571 | Organic compounds containing the thiophosphoric acid amide functional group RN(R')OP(O)(O)=S, R,R'=H, alkyl, or aryl group. |
| Organic thiophosphoric acid halides | CHEMONTID:0001573 | Organic compounds containing the thiophosphoric acid halide functional group, with the general structure RP(R')(X)=S, where R,R',R'' = O,N and X = halogen group. |
| Organic thiophosphoric acids | CHEMONTID:0001219 | Organic compounds containing the thiophosphoric acid group ([H]OP(=S)(O[H])O[H]). |
| Organic thiophosphoric acids and derivatives | CHEMONTID:0001303 | Organic compounds containing the thiophosphoric acid functional group or a derivative thereof, with the general structure RP(R')(R'')=S, where R,R',R'' = O,N, halogen residue. |
| Organic thiosulfate salts | CHEMONTID:0004457 | Organic salts of the thiosulfate ion. |
| Organic thiosulfates | CHEMONTID:0002080 | Organic compounds containing the thiosulfate oxoanion, with the formula [S2O3]2-, or its conjugate base. |
| Organic thiosulfinic acids | CHEMONTID:0004703 | Organic compounds containing a thiosulfinyl group (HS(S)OH). They have the general structure RS(=S)OH, where R = H or organyl. |
| Organic thiosulfuric acids and derivatives | CHEMONTID:0002035 | Organic compounds containing the thiosulfuric acid functional group or a derivative thereof. |
| Organic tin salts | CHEMONTID:0004038 | Organic salt compounds containing a tin atom in its ionic form. |
| Organic transition metal salts | CHEMONTID:0003997 | Organic salt compounds containing a transition metal atom in its ionic form. |
| Organic triazanes | CHEMONTID:0003992 | Organic compounds containing the triazane group (NH2NHNH2) or a hydrocarbyl derivative thereof. |
| Organic triazenes | CHEMONTID:0001898 | Organic compounds containing the triazene group (-N-N=N), which consists of an amine directly bonding to an azo group. |
| Organic trisulfides | CHEMONTID:0002799 | Organosulfur compounds with the general formula RSSSR' (R,R'=alkyl, aryl). |
| Organic zwitterions | CHEMONTID:0003610 | Organic neutral compounds having formal unit electrical charges of opposite sign. |
| Organo-alkali-metal compounds | CHEMONTID:0001372 | Organic compounds containing an alkali metal atom. |
| Organo-post-transition metal compounds | CHEMONTID:0001523 | Organic compounds containing a post-transition metal atom. |
| Organoalkaline-earth metal compounds | CHEMONTID:0000277 | Organic compounds containing an alkaline earth metal atom. |
| Organoaluminium compounds | CHEMONTID:0001529 | Compounds containing bond between a carbon atom and an aluminum atom. |
| Organoantimony compounds | CHEMONTID:0000349 | Compounds containing a bond between a carbon atom and an antimony atom. |
| Organoarsenic compounds | CHEMONTID:0000405 | Compounds containing bond between a carbon atom and an arsenic atom. |
| Organoarsenic sulfides | CHEMONTID:0004241 | Organoarsenic compounds with the general formula R[As]S, where R = organyl group. |
| Organoarsinous acid esters | CHEMONTID:0004247 | Organoarsonous acid derivatives, where the hydrogen atom of the hydroxyl group is replaced by an organyl group. |
| Organoarsinous acids | CHEMONTID:0004248 | As-hydrocarbyl compounds with the general formula R2As(OH), where R is an organic group. |
| Organoarsonous acids | CHEMONTID:0003337 | As-hydrocarbyl compounds with the general formula RAs(OH)2, where R is an organic group. |
| Organoastatides | CHEMONTID:0001514 | Compounds containing a chemical bond between a carbon atom and an astatin atom. |
| Organoazides | CHEMONTID:0004467 | Compounds bearing the group N3, viz. -N=N+=N- attached to an organic group. |
| Organoboron compounds | CHEMONTID:0002795 | Organic compounds containing a carbon-boron bond. |
| Organoboroxines | CHEMONTID:0003222 | Organic compounds containing a boroxine ring B-substituted with an organyl group. |
| Organobromides | CHEMONTID:0001515 | Compounds containing a chemical bond between a carbon atom and a bromine atom. |
| Organochlorides | CHEMONTID:0001516 | Compounds containing a chemical bond between a carbon atom and a chlorine atom. |
| Organochlorosilanes | CHEMONTID:0004444 | Organosilicon compounds where the tetravalent silicon atom is linked to one or more chlorine atoms. |
| Organochromium compounds | CHEMONTID:0004073 | Compounds containing a bond between a carbon atom and a chromium atom. |
| Organocopper compounds | CHEMONTID:0004017 | Compounds containing a bond between a carbon atom and a copper atom. |
| Organofluorides | CHEMONTID:0001517 | Compounds containing a chemical bond between a carbon atom and a fluorine atom. |
| Organogold compounds | CHEMONTID:0000473 | Organic compounds containing a bond between a carbon atom and a gold atom. |
| Organohalogen compounds | CHEMONTID:0000267 | Organic compounds containing a bond between a carbon atom and a halogen atom (At, F, Cl, Br, I). |
| Organoheterocyclic compounds | CHEMONTID:0000002 | Compounds containing a ring with least one carbon atom and one non-carbon atom. |
| Organoheterosilanes | CHEMONTID:0004445 | Organosilicon compounds where the tetravalent silicon atom is linked to one or more heteroatoms. |
| Organoiodides | CHEMONTID:0001518 | Compounds containing a chemical bond between a carbon atom and an iodine atom. |
| Organolead compounds | CHEMONTID:0004024 | Compounds containing bond between a carbon atom and a lead atom. |
| Organolead sulfides | CHEMONTID:0004288 | Organolead compounds containing a divalent selenium atom linked to two lead atoms, each linked to at least one organyl group. |
| Organolithium compounds | CHEMONTID:0000406 | Organic compounds containing a bond between a carbon atom and lithium atom. |
| Organomagnesium compounds | CHEMONTID:0000287 | Organic compounds containing a bond between a carbon atom and magnesium atom. |
| Organomagnesium halides | CHEMONTID:0004594 | Organomagnesium compounds with the formula RMgX, where R=organyl group, and X = halogen atom. |
| Organomercurial compounds | CHEMONTID:0000407 | Organic compounds containing a bond between a carbon atom and mercury atom. |
| Organometallic compounds | CHEMONTID:0000462 | Organic compounds containing a bond between a carbon atom and metal atom. |
| Organometallic peroxides | CHEMONTID:0004614 | Organic compounds that contain a peroxide group substituted with a an organometallic group. |
| Organometalloid compounds | CHEMONTID:0001370 | Organic compounds containing a metalloid atom. |
| Organonickel compounds | CHEMONTID:0004492 | Organic compounds containing a bond between a carbon atom and a nickel atom. |
| Organonitrogen compounds | CHEMONTID:0000278 | Organic compounds containing a nitrogen atom. |
| Organooxygen compounds | CHEMONTID:0000323 | Organic compounds containing a bond between a carbon atom and an oxygen atom. |
| Organophosphine oxides | CHEMONTID:0001309 | Organic compounds containing the phosphine oxide group, with the general formula R3P=O or R3P+O-. |
| Organophosphinic acids and derivatives | CHEMONTID:0003014 | P-hydrocarbyl derivatives of phosphinic acid. |
| Organophosphorotrithioic acids and derivatives | CHEMONTID:0001570 | Organic compounds containing the organophosphorotrithioic acid structure or a derivative thereof. They have the general structure ROP(=S)(SR')SR\", where R-R\"= any atom. |
| Organophosphorus compounds | CHEMONTID:0000400 | Organic compounds containing the phosphorus atom. |
| Organopnictogen compounds | CHEMONTID:0004557 | Compounds containing a bond between carbon a pnictogen atom. Pnictogens are p-block element atoms that are in the group 15 of the periodic table. |
| Organoselenium compounds | CHEMONTID:0002468 | Organic compounds containing a carbon-selenium bond. |
| Organosilicon compounds | CHEMONTID:0003194 | Organic compounds containing a C[Si] bond. |
| Organosilver compounds | CHEMONTID:0004025 | Organic compounds containing a bond between a carbon atom and a silver atom. |
| Organosulfenic acid amides | CHEMONTID:0001172 | Compounds derived from a sulfenic acid, RSOH (R= organyl, not H), by replacement of -OH by -NR2. |
| Organosulfenic acid halides | CHEMONTID:0001174 | Compounds derived from a sulfenic acid, RSOH (R = organyl, not H), where the hydroxyl group is replace by a halogen atom. |
| Organosulfenic acids | CHEMONTID:0001235 | Compounds containing a sulfenic acid functional group, with the general structure RSOH (R not H). |
| Organosulfenic acids and derivatives | CHEMONTID:0000268 | Compounds derived from sulfenic acid, with the general formula R1SR2 ( R1= organyl, R2=any heteroatom). |
| Organosulfonamides | CHEMONTID:0001585 | Compounds containing the sulfonamide functional group, an amide of sulfonic acid with the general structure R1S(=O)2N(R2)R3 (R1=alkyl, aryl; R2,R3=H, alkyl, aryl). |
| Organosulfonic acid esters | CHEMONTID:0001178 | Esters of sulfonic acid, which have the general structure RS(=O)2OR' (R,R' = organyl, not H). |
| Organosulfonic acids | CHEMONTID:0001179 | Compounds containing the sulfonic acid group, which has the general structure RS(=O)2OH (R is not a hydrogen atom). |
| Organosulfonic acids and derivatives | CHEMONTID:0000270 | Compounds containing a sulfonic acid or derivative, with the general structure RS(=O)2X (R=alkyl, aryl; X=any heteroatom). |
| Organosulfonic anhydrides | CHEMONTID:0003990 | Organic compounds having the structure RS(=O)2OS(=O)2R', where R = organyl group and R' = H or organyl group. |
| Organosulfur compounds | CHEMONTID:0000004 | Organic compounds containing a carbon-sulfur bond. |
| Organotellurium compounds | CHEMONTID:0002469 | Compounds containing bond between a carbon atom and a tellurium atom. |
| Organotetrahaloarsoranes | CHEMONTID:0004243 | Organoarsenic compounds, having a pentavalent arsenic atom linked to four halogen atoms and a organic group. |
| Organothalium compounds | CHEMONTID:0004539 | Compounds containing a bond between a carbon atom and a thalium atom. |
| Organothiophosphorus compounds | CHEMONTID:0001438 | Organic derivatives of thiophosphonic acid, thiophosphoric acid, dithiophosphoric acid, or phosphorotrithioic acid, or derivatives thereof. Thiophosphonic acid, dithiophosphoric acid, thiophosphoric acid, and phosphorotrithioic acid are thiophosphorus compounds with the formula OP(O)(=S), OP(S)(=S)O, OP(O)(=S)O, and OP(=S)(S)S, respectively. |
| Organotin compounds | CHEMONTID:0001524 | Compounds containing bond between a carbon atom and a tin atom. |
| Organotin selenides | CHEMONTID:0004285 | Organotin compounds containing a divalent selenium atom linked to two tin atoms, each linked to at least one organyl group. |
| Organotin sulfides | CHEMONTID:0004286 | Organotin compounds containing a divalent sulfur atom linked to two tin atoms, each linked to at least one organyl group. |
| Organotin tellurides | CHEMONTID:0004287 | Organotin compounds containing a divalent tellurium atom linked to two tin atoms, each linked to at least one organyl group. |
| Organotransition metal compounds | CHEMONTID:0001371 | Organic compounds containing a transition metal atom. |
| Organozinc compounds | CHEMONTID:0004592 | Organometallic compounds that contain a chemical bond between a carbon atom and a zinc atom. |
| Ormosia-type alkaloids | CHEMONTID:0002825 | Aloperine alkaloids with a structure based on the ormosanine skeleton. |
| Ortho acids | CHEMONTID:0002928 | Ortho acid derivatives of carboxylic acids, with the general formula RC(OH)3. |
| Ortho amides | CHEMONTID:0002927 | Hypothetical Compounds having the general structure RC(NH2)3, and N-substituted derivatives thereof. |
| Ortho cresols | CHEMONTID:0001274 | Organic compounds containing an ortho-cresol moiety, which consists of a benzene bearing one hydroxyl group at ring positions 1 and 2, respectively. |
| Ortho dioxins | CHEMONTID:0001385 | Compounds containing a dioxin ring, in which the two oxygen atoms are at positions 1 and 2 respectively. |
| Ortho esters | CHEMONTID:0002926 | Compounds having the general structure RC(OR')3 ( R' not H), or the structure C(OR')4 ( R' not H). |
| Ortho thiazepines | CHEMONTID:0001353 | Compounds containing a thiazepine ring, in which the sulfur and nitrogen atoms are at positions 1 and 2 respectively. |
| Orthocarboxylic acid derivatives | CHEMONTID:0001236 | Organic compounds containing the orhtocarboxylic acid functional group, with the RC(X)(X)X (R=H, alkyl, aryl; X=OH, alkoxy, aryloxy, substituted amino, etc.). |
| OS-thioperoxols | CHEMONTID:0003157 | Thioperoxols with the general formula R-OSH (R = organyl group). |
| Other glycerolipids | CHEMONTID:0001512 | Glycerolipids that do not belong to either the class Alk(en)yl Diacylglycerols, Diacylglycerols, Glycosylglycerols, Monoacylglycerols, Other Glycerolipids or Triacylglycerols. |
| Other glycerophosphoinositol phosphates | CHEMONTID:0001718 | Glycerophosphoinositol phosphates not belonging to Lysophosphatidylinositol Phosphates, or the Phosphatidylinositol Phosphates. |
| Other hydroperoxyeicosapolyenoic acids | CHEMONTID:0001525 | Hydroperoxyeicosapolyenoic acids which do not belong to the hydroperoxyeicosapentaenoic acids, the hydroperoxyeicosatetraenoic acids, or the hydroperoxyeicosatrienoic acids. |
| Other hydroxyeicosapolyenoic acids | CHEMONTID:0001422 | Hydroxyeicosapolyenoic acids which do not belong to the Hydroxyeicosapentaenoic acids, the Hydroxyeicosatetraenoic acids, or the Hydroxyeicosatrienoic acids. |
| Other mixed metal/non-metal oxoanionic compounds | CHEMONTID:0001442 | Inorganic compounds containing a non-metal atom linked to a metallic oxoanionic moiety. |
| Other non-metal halides | CHEMONTID:0000437 | Inorganic compounds containing 'other non-metals' and halogen. |
| Other non-metal hydrides | CHEMONTID:0000552 | Inorganic compounds in which the heaviest atom bonded to a hydrogen atom is belongs to the class of 'other non-metals'. |
| Other non-metal nitrides | CHEMONTID:0000553 | Inorganic compounds of nitrogen where nitrogen has a formal oxidation state of −3, and the heaviest atom bonded to it belongs to the class of 'other non-metals'. |
| Other non-metal organides | CHEMONTID:0000453 | Inorganic compounds belonging to either of the other non-metal Hydrides, other non-metal nitrides, other non-metal oxides, or the other non-metal sulfides. |
| Other non-metal oxides | CHEMONTID:0000554 | Inorganic compounds containing an oxygen atom of an oxidation state of -2, in which the heaviest atom bonded to the oxygen belongs to the class of 'other non-metals'. |
| Other non-metal sulfides | CHEMONTID:0000555 | Inorganic compounds containing a sulfur atom of an oxidation state of -2, in which the heaviest atom bonded to the oxygen belongs to the class of other non-metals. |
| Oxaborine derivatives | CHEMONTID:0001717 | Compounds containing a six-member aliphatic heterocycle made up of one oxygen atom, a boron atom, and three carbon atoms. |
| Oxaborole derivatives | CHEMONTID:0002227 | Compounds containing a five-member aliphatic heterocycle made up of one oxygen atom, a boron atom, and three carbon atoms. |
| Oxacephems | CHEMONTID:0000171 | Organic compounds containing the oxacepehem skeleton, which is similar to a cephem, but with oxygen substituted for the sulfur. |
| Oxacyclic compounds | CHEMONTID:0004140 | Organic compounds containing an heterocycle with at least one oxygen atom linked to a ring carbon. |
| Oxadiazines | CHEMONTID:0004736 | Heterocyclic compounds containing an oxadiazine ring, which is an unsaturated six-membered heterocycle that consists of one oxygen 2 nitrogen, and 3 carbon atoms. |
| Oxadiazoles | CHEMONTID:0001822 | Organic compounds containing an oxadiazole ring, which is a five-member aromatic heterocycle with two nitrogen atoms, an oxygen atom, and a carbon atom. |
| Oxadiazolidines | CHEMONTID:0001933 | Organic compounds containing an oxadiazole ring, which is a five-member saturated aliphatic heterocycle with two nitrogen atoms, an oxygen atom, and two carbon atoms. |
| Oxaergolines | CHEMONTID:0002681 | Alkaloids with a structure based on the oxaergoline skeleton, an analog of ergoline obtained by substituted one of the pyridine C atom by an oxygen atom. |
| Oxamorphinans | CHEMONTID:0001785 | Polycyclic compounds with a four-ring skeleton with three condensed six-member rings forming a partially hydrogenated naphthopyran moiety, one of which is aromatic while the two others are alicyclic. |
| Oxanes | CHEMONTID:0002012 | Compounds containing an oxane (tetrahydropyran) ring, which is a six-member saturated aliphatic heterocycle with one oxygen atom and five carbon atoms. |
| Oxaphospholanes | CHEMONTID:0000782 | Compounds containing an oxaphospholane moiety, which consists of a saturated aliphatic five-member ring with two oxygen atoms, a phosphorus atom, and two carbon atoms. Isomers of oxaphospholane include 1,2-oxaphosphane, and 1,3-oxaphospholane. |
| Oxasteroids and derivatives | CHEMONTID:0002382 | Steroid derivatives where a carbon atom of the steroid is replaced by an oxygen atom. |
| Oxathianes | CHEMONTID:0001889 | Compounds containing an oxathiane moiety, which consists of a saturated aliphatic six-member ring with one oxygen atom, a sulfur atom, and four carbon atoms. Isomers of oxaphospholane include 1,2-oxathiane, 1,3-oxathiane,and 1,4-oxathiane. |
| Oxathiaphospholanes | CHEMONTID:0002649 | Heterocyclic compounds containing an oxathiophospholane ring, which is a saturated, five-membered ring with one oxygen atom, one sulfur atom, one phosphorus atom and two carbon atoms. |
| Oxathiazolidines | CHEMONTID:0002578 | Heterocyclic compounds containing an oxathiazolidine, a saturated five-membered ring having two carbon atoms, one oxygen atom, one nitrogen atom, and one sulfur atom. |
| Oxathietanes | CHEMONTID:0001886 | Compounds containing an oxathietane moiety, which consists of a saturated aliphatic four-member ring with one oxygen atom, a sulfur atom, and two carbon atoms. Isomers of oxaphospholane include 1,2-oxathietane, and 1,3-oxathietane. |
| Oxathiins | CHEMONTID:0002058 | Compounds containing an oxathiin moiety, which consists of an unsaturated aliphatic six-member ring with one oxygen atom, a sulfur atom, and four carbon atoms. Isomers of oxaphospholane include 1,2-oxathiin, 1,3-oxathiin,and 1,4-oxathiin. |
| Oxathiolanes | CHEMONTID:0000106 | Compounds containing an oxathiolane moiety, which consists of a saturated aliphatic five-member ring with one oxygen atom, a sulfur atom, and three carbon atoms. Isomers of oxaphospholane include meta-oxathiolane, and ortho-oxathiolane. |
| Oxathioles | CHEMONTID:0002261 | Organic heterocyclic compounds containing a saturated five-membered ring with three carbon atoms, one oxygen atom, one sulfur atom, and one double bond. |
| Oxatriazoles | CHEMONTID:0001931 | Compounds containing an oxatriazole moiety, which consists of an unsaturated aliphatic five-member ring with one oxygen atom, three nitrogen, one carbon atom, and two double bonds. Isomers of oxatriazole include 1,2,3,4-oxatriazole, and 1,2,3,5-oxatriazole. |
| Oxatriazolidines | CHEMONTID:0001932 | Organic compounds containing an oxatriazolidine ring, which is a five-member saturated aliphatic heterocycle with three nitrogen atoms, an oxygen atom, and a carbon atom. |
| Oxazaphosphinanes | CHEMONTID:0002466 | Organic heterocyclic compounds containing an oxazaphosphinane ring, which consists of three carbon atoms, one nitrogen atom, and one phosphorus atom. |
| Oxazepines | CHEMONTID:0000066 | Compounds containing an oxazepine moiety, which consists of an unsaturated aliphatic seven-member ring with one oxygen atom, a nitrogen atom, and five carbon atoms. Isomers of oxazepine include 1,2-oxazepine, 1,3-oxazepine,and 1,4-oxazepine. |
| Oxazinanes | CHEMONTID:0000107 | Compounds containing an oxazinane moiety, which consists of a saturated aliphatic six-member ring with one oxygen atom, a nitrogen atom, and four carbon atoms. Isomers of oxaphospholane include 1,2-oxazinane, 1,3-oxazinane, and 1,4-oxazinane. |
| Oxazines | CHEMONTID:0000082 | Compounds containing an oxazine moiety, which consists of an unsaturated aliphatic six-member ring with one oxygen atom, a nitrogen atom, four carbon atoms, and two double bonds. Isomers of oxaphospholane include 1,2-oxazine, 1,3-oxazine, and 1,4-oxazine. |
| Oxaziridines | CHEMONTID:0003092 | Organic heterocyclic compounds containing oxaziridine, a three-membered ring containing an oxygen atom, a carbon atom, and a nitrogen atom. |
| Oxazoles | CHEMONTID:0000083 | Compounds containing an oxazole ring, which is a five-membered aromatic heterocycle with one oxygen, one nitrogen, and three carbon atoms. Isomers include 1,2-oxazole and 1,3-oxazole. |
| Oxazolidinediones | CHEMONTID:0000197 | Compounds containing an oxazolidine ring which bears two ketones. |
| Oxazolidines | CHEMONTID:0000108 | Compounds containing an oxazolidine moiety, which consists of a saturated aliphatic five-member ring with one oxygen atom, one nitrogen, three carbon atoms, and two double bonds. |
| Oxazolidinones | CHEMONTID:0000196 | Compounds containing an oxazolidinone moiety, which is an oxazolidine bearing a ketone group. |
| Oxazolines | CHEMONTID:0000084 | Organic compounds containing 1,3-oxazoline, a five-membered ring with a nitrogen and an oxygen atoms at the 1- and 3-position, respectively. Additionally, it contains two double bonds. |
| Oxazolopyrazines | CHEMONTID:0002197 | Polycyclic compounds containing an oxazole ring fused to a pyrazine ring. |
| Oxazolopyridines | CHEMONTID:0002118 | Polycyclic compounds containing an oxazole ring fused to a pyridine ring. |
| Oxepanes | CHEMONTID:0001729 | Compounds containing an oxepane ring, which is a seven-member saturated aliphatic heterocycle with one oxygen and six carbon atoms. |
| Oxetane amino acids and derivatives | CHEMONTID:0001695 | Sugar amino acids containing an oxetane ring between the carboxy- and the amino terminals of the amino acid chain. |
| Oxetanes | CHEMONTID:0000070 | Compounds containing an oxetane ring, which is a four-member saturated aliphatic ring with an oxygen, and three carbon atoms. |
| Oxetenes | CHEMONTID:0000073 | Compounds containing an oxetene ring, which is a four-member unsaturated aliphatic ring with an oxygen, three carbon atoms, and one CC double bond. |
| Oxime carbamates | CHEMONTID:0004752 | Oxime ether derivatives with the general formula CC(R)=NOC(=O)N(R')R\", where R-R\" = H or organyl. |
| Oxime esters | CHEMONTID:0003879 | Organic compounds containing an ester derivative of the oxime functional group. |
| Oxime ethers | CHEMONTID:0001010 | Compounds containing the oxime ether functional group, with the general structure R1(R2)C=NOR3 ( R3 not H). |
| Oxime organothiophosphates | CHEMONTID:0004765 | Organic compounds containing an oxime group, which is O-substituted with a thiophosphoric acid ester. |
| Oximes | CHEMONTID:0000411 | Compounds containing the oxime functional group, with the general structure R1(R2)C=NOH. |
| Oxirane carboxylic acids | CHEMONTID:0002409 | Compounds containing an oxirane ring bearing a carboxylic acid group. |
| Oxirane carboxylic acids and derivatives | CHEMONTID:0001864 | Compounds containing an oxirane ring bearing a carboxylic acid group (or a derivative thereof). |
| Oxirenes | CHEMONTID:0004170 | Organic compounds containing oxirene, an unsaturated three-membered ring with two carbon atoms and one oxygen atom. |
| Oxocins | CHEMONTID:0001796 | Compounds containing an oxocin ring, which is a eight-member unsaturated aromatic ring containing one oxygen atom and seven carbon atoms. |
| Oxoeicosapolyenoic acids | CHEMONTID:0000393 | Eicosapolyenoic acids (C20 fatty acid with more than one C=C double bonds on the chain). |
| Oxoisoaporphines | CHEMONTID:0004118 | Alkaloids with a structure that contains the isoaporphine skeleton with an oxo group at the 7-position. |
| Oxolanes | CHEMONTID:0001967 | Organic compounds containing an oxolane (tetrahydrofuran) ring, which is a saturated aliphatic five-member ring containing one oxygen and five carbon atoms. |
| Oxonium ylides | CHEMONTID:0003701 | Compounds having the general structure R2[O+]-C-R2. Oxonium ylides also constituted a class of 1,3-dipolar compounds of general structure R2C=[O+]-Y- , comprising carbonyl imides, carbonyl oxides and carbonyl ylides. |
| Oxoprolines | CHEMONTID:0002089 | Compounds containing an oxoproline moiety, which consists of a pyrrolidine ring bearing a carboxylic acid group at the ring position 2, and a ketone group. |
| Oxosteroids | CHEMONTID:0001194 | Steroid derivatives carrying a C=O group attached to steroid skeleton. |
| Oxygen-containing organoarsenic compounds | CHEMONTID:0004280 | Organoarsenic compounds that containing an oxygen atom. |